cas: 20017-68-9 — see every product listed under this CAS number, including other names
1-Bromo-3,3-diphenylpropane, 98% (CAS 20017-68-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F041087-1G |
| cas | 20017-68-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 294.71 Pln | |
| Fluorochem | 5g | 924.69 Pln | |
| Fluorochem | 10g | 1528.65 Pln | |
| Fluorochem | 25g | 3205.14 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3-bromo-1-phenylpropyl)benzene (CAS 20017-68-9) is a chemical compound with the molecular formula C15H15Br and a molecular weight of 275.18 g/mol. IUPAC name: (3-bromo-1-phenylpropyl)benzene. InChIKey: SLHSRCBFPHCSGL-UHFFFAOYSA-N.
| Molecular formula | C15H15Br |
|---|---|
| Molecular weight | 275.18 g/mol |
| IUPAC name | (3-bromo-1-phenylpropyl)benzene |
| InChIKey | SLHSRCBFPHCSGL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CCBr)C2=CC=CC=C2 |
Computed by PubChem (NCBI)