cas: 20017-68-9 — see every product listed under this CAS number, including other names
3,3-Diphenylpropyl Bromide, >98.0%(GC)(T) (CAS 20017-68-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2784-5G |
| cas | 20017-68-9 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 733.00 Pln | |
| TCI | 25g | 2306.52 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
(3-bromo-1-phenylpropyl)benzene (CAS 20017-68-9) is a chemical compound with the molecular formula C15H15Br and a molecular weight of 275.18 g/mol. IUPAC name: (3-bromo-1-phenylpropyl)benzene. InChIKey: SLHSRCBFPHCSGL-UHFFFAOYSA-N.
| Molecular formula | C15H15Br |
|---|---|
| Molecular weight | 275.18 g/mol |
| IUPAC name | (3-bromo-1-phenylpropyl)benzene |
| InChIKey | SLHSRCBFPHCSGL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CCBr)C2=CC=CC=C2 |
Computed by PubChem (NCBI)