cas: 2121512-94-3 — see every product listed under this CAS number, including other names
(3-Chloro-2,6-dimethoxypyridin-4-yl)boronic acid, 98% (CAS 2121512-94-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1195328-10g |
| cas | 2121512-94-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 26474.56 Pln | |
| AmBeed | 25g | 51948.19 Pln | |
| AmBeed | 5g | 15557.29 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3-chloro-2,6-dimethoxy-4-pyridinyl)boronic acid (CAS 2121512-94-3) is a chemical compound with the molecular formula C7H9BClNO4 and a molecular weight of 217.42 g/mol. IUPAC name: (3-chloro-2,6-dimethoxy-4-pyridinyl)boronic acid. InChIKey: GXOHPFUKUXAMAU-UHFFFAOYSA-N.
| Molecular formula | C7H9BClNO4 |
|---|---|
| Molecular weight | 217.42 g/mol |
| IUPAC name | (3-chloro-2,6-dimethoxy-4-pyridinyl)boronic acid |
| InChIKey | GXOHPFUKUXAMAU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1Cl)OC)OC)(O)O |
Computed by PubChem (NCBI)