cas: 2121512-94-3 — see every product listed under this CAS number, including other names
3-Chloro-2,6-dimethoxypyridin-4-ylboronic acid, ≥95%, ≥95% (CAS 2121512-94-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132NRR-1g |
| cas | 2121512-94-3 |
| size | 1g |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2123.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(3-chloro-2,6-dimethoxy-4-pyridinyl)boronic acid (CAS 2121512-94-3) is a chemical compound with the molecular formula C7H9BClNO4 and a molecular weight of 217.42 g/mol. IUPAC name: (3-chloro-2,6-dimethoxy-4-pyridinyl)boronic acid. InChIKey: GXOHPFUKUXAMAU-UHFFFAOYSA-N.
| Molecular formula | C7H9BClNO4 |
|---|---|
| Molecular weight | 217.42 g/mol |
| IUPAC name | (3-chloro-2,6-dimethoxy-4-pyridinyl)boronic acid |
| InChIKey | GXOHPFUKUXAMAU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1Cl)OC)OC)(O)O |
Computed by PubChem (NCBI)