CAS 2096339-93-2 appears in our catalog under these names: 5-chloro-2,3-dimethoxypyridine-4-boronic acid, 97%, (5-Chloro-2,3-dimethoxypyridin-4-yl)boronic acid 97%, 5-Chloro-2,3-dimethoxypyridine-4-boronic acid, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg.
(5-chloro-2,3-dimethoxy-4-pyridinyl)boronic acid (CAS 2096339-93-2) is a chemical compound with the molecular formula C7H9BClNO4 and a molecular weight of 217.42 g/mol. IUPAC name: (5-chloro-2,3-dimethoxy-4-pyridinyl)boronic acid. InChIKey: ULFBXDQPYQISEH-UHFFFAOYSA-N.
| Molecular formula | C7H9BClNO4 |
|---|---|
| Molecular weight | 217.42 g/mol |
| IUPAC name | (5-chloro-2,3-dimethoxy-4-pyridinyl)boronic acid |
| InChIKey | ULFBXDQPYQISEH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=NC=C1Cl)OC)OC)(O)O |
Computed by PubChem (NCBI)