(3-Chloro-2-hydroxyphenyl)boronic acid, 98%
cas: 951655-50-8 — see every product listed under this CAS number, including other names
(3-Chloro-2-hydroxyphenyl)boronic acid, 98% (CAS 951655-50-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F338047-250MG |
| cas | 951655-50-8 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 336.36 Pln | |
| Fluorochem | 5g | 1106.92 Pln | |
| Fluorochem | 25g | 4616.10 Pln | |
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 1076.81 Pln | |
| Ambeed | 25g | 3668.94 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 299.60 Pln | |
| Chemat | 5g | 1250.00 Pln | |
| Chemat | 25g | 5886.80 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(3-chloro-2-hydroxyphenyl)boronic acid (CAS 951655-50-8) is a chemical compound with the molecular formula C6H6BClO3 and a molecular weight of 172.37 g/mol. IUPAC name: (3-chloro-2-hydroxyphenyl)boronic acid. InChIKey: UCAKTFSAEMHJJE-UHFFFAOYSA-N.
| Molecular formula | C6H6BClO3 |
|---|---|
| Molecular weight | 172.37 g/mol |
| IUPAC name | (3-chloro-2-hydroxyphenyl)boronic acid |
| InChIKey | UCAKTFSAEMHJJE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)Cl)O)(O)O |
Computed by PubChem (NCBI)