CAS 766549-26-2 appears in our catalog under these names: 2–chloro–4–hydroxyphenylboronic acid, 2-Chloro-4-hydroxyphenylboronic acid, 98%, 2-Chloro-4-Hydroxyphenylboronic Acid, 98%, 98%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 10g, 5g, 100mg.
(2-chloro-4-hydroxyphenyl)boronic acid (CAS 766549-26-2) is a chemical compound with the molecular formula C6H6BClO3 and a molecular weight of 172.37 g/mol. IUPAC name: (2-chloro-4-hydroxyphenyl)boronic acid. InChIKey: NRBQMBXPVAUMJY-UHFFFAOYSA-N.
| Molecular formula | C6H6BClO3 |
|---|---|
| Molecular weight | 172.37 g/mol |
| IUPAC name | (2-chloro-4-hydroxyphenyl)boronic acid |
| InChIKey | NRBQMBXPVAUMJY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)O)Cl)(O)O |
Computed by PubChem (NCBI)