Products 89488-25-5
CAS 89488-25-5 appears in our catalog under these names: 5-Chloro-2-hydroxyphenylboronic acid, 96%, 5-Chloro-2-hydroxyphenylboronic acid, 97%, 5-Chloro-2-hydroxyphenylboronic acid, 98%, 98%, (5-Chloro-2-hydroxyphenyl)boronic Acid (contains varying amounts of Anhydride). Offered by: Combi-blocks, Fluorochem, Chemat, TCI. Available pack sizes: 5g, 10g, 25g, 1g, 50g, 100g, 100mg, 250mg.
(5-chloro-2-hydroxyphenyl)boronic acid (CAS 89488-25-5) is a chemical compound with the molecular formula C6H6BClO3 and a molecular weight of 172.37 g/mol. IUPAC name: (5-chloro-2-hydroxyphenyl)boronic acid. InChIKey: GGZASRFCRAZNPO-UHFFFAOYSA-N.
| Molecular formula | C6H6BClO3 |
|---|---|
| Molecular weight | 172.37 g/mol |
| IUPAC name | (5-chloro-2-hydroxyphenyl)boronic acid |
| InChIKey | GGZASRFCRAZNPO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)O)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(5-Chloro-2-hydroxyphenyl)boronic Acid (contains varying amounts of Anhydride), (5-Chloro-2-hydroxyphenyl)boronic acid, 5-Chloro-2-hydroxybenzeneboronic acid, (5-Chloro-2-hydroxyphenyl) boronic acid, 5-Chloro-2-hydroxyphenylboronic acid, AldrichCPR, Boronic acid, (5-chloro-2-hydroxyphenyl)-, 5-Chloro-2-Hydroxyphenyl-Boronic Acid