cas: 1485110-17-5 — see every product listed under this CAS number, including other names
(3-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanol 98% (CAS 1485110-17-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A735525-100mg |
| cas | 1485110-17-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 248.00 Pln | |
| Ambeed | 5g | 909.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A735525 |
[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol (CAS 1485110-17-5) is a chemical compound with the molecular formula C13H18BClO3 and a molecular weight of 268.54 g/mol. IUPAC name: [3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol. InChIKey: AAZKVONTUGPEJQ-UHFFFAOYSA-N.
| Molecular formula | C13H18BClO3 |
|---|---|
| Molecular weight | 268.54 g/mol |
| IUPAC name | [3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol |
| InChIKey | AAZKVONTUGPEJQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)CO)Cl |
Computed by PubChem (NCBI)