CAS 1416722-82-1 appears in our catalog under these names: 2-Chloro-4-methoxyphenylboronic acid pinacol ester, 97%, 2-Chloro-4-methoxyphenylboronic acid pinacol ester, 2-(2-Chloro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 97%, 2-Chloro-4-methoxyphenylboronic acid pinacol ester, 97%, 97%, 2-(2-Chloro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250mg, 100mg.
2-(2-chloro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1416722-82-1) is a chemical compound with the molecular formula C13H18BClO3 and a molecular weight of 268.54 g/mol. IUPAC name: 2-(2-chloro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZCWOKWCBYZCXPV-UHFFFAOYSA-N.
| Molecular formula | C13H18BClO3 |
|---|---|
| Molecular weight | 268.54 g/mol |
| IUPAC name | 2-(2-chloro-4-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZCWOKWCBYZCXPV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)OC)Cl |
Computed by PubChem (NCBI)