CAS 1544673-40-6 appears in our catalog under these names: 2-Chloro-5-hydroxymethylphenylboronic acid, pinacol ester, 96%, 2-Chloro-5-hydroxymethylphenylboronic Acid, Pinacol Ester. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 0,5g.
[4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol (CAS 1544673-40-6) is a chemical compound with the molecular formula C13H18BClO3 and a molecular weight of 268.54 g/mol. IUPAC name: [4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol. InChIKey: RFVQXDMOGKDUFW-UHFFFAOYSA-N.
| Molecular formula | C13H18BClO3 |
|---|---|
| Molecular weight | 268.54 g/mol |
| IUPAC name | [4-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol |
| InChIKey | RFVQXDMOGKDUFW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)CO)Cl |
Computed by PubChem (NCBI)