cas: 1228582-53-3 — see every product listed under this CAS number, including other names
(3-Chloro-4-phenoxyphenyl)methanol, 98% (CAS 1228582-53-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 5g, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1480471-25g |
| cas | 1228582-53-3 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 34599.04 Pln | |
| AmBeed | 10g | 13884.22 Pln | |
| AmBeed | 5g | 9275.14 Pln | |
| Fluorochem | 500mg | 1226.67 Pln | |
| Fluorochem | 1g | 1684.84 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3-chloro-4-phenoxyphenyl)methanol (CAS 1228582-53-3) is a chemical compound with the molecular formula C13H11ClO2 and a molecular weight of 234.68 g/mol. IUPAC name: (3-chloro-4-phenoxyphenyl)methanol. InChIKey: MCXXCASXFWENBY-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO2 |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | (3-chloro-4-phenoxyphenyl)methanol |
| InChIKey | MCXXCASXFWENBY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)CO)Cl |
Computed by PubChem (NCBI)