Products 6280-43-9
CAS 6280-43-9 appears in our catalog under these names: 4-(4-Chlorobenzyl)benzene-1,3-diol, 95%, 4–(4–Chlorobenzyl)benzene–1，3–diol, 4-(4-Chlorobenzyl)benzene-1,3-diol 95%, 4-(4-Chlorobenzyl)benzene-1,3-diol, 97%,RG, 97%,RG, 4-(4-Chlorobenzyl)benzene-1,3-diol. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 50mg.
4-[(4-chlorophenyl)methyl]benzene-1,3-diol (CAS 6280-43-9) is a chemical compound with the molecular formula C13H11ClO2 and a molecular weight of 234.68 g/mol. IUPAC name: 4-[(4-chlorophenyl)methyl]benzene-1,3-diol. InChIKey: MJYNBOVNNIZYEI-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO2 |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 4-[(4-chlorophenyl)methyl]benzene-1,3-diol |
| InChIKey | MJYNBOVNNIZYEI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=C(C=C(C=C2)O)O)Cl |
Computed by PubChem (NCBI)