CAS 1189360-82-4 is the registry number for 2-(benzyloxy)-5-chlorophenol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
5-chloro-2-phenylmethoxyphenol (CAS 1189360-82-4) is a chemical compound with the molecular formula C13H11ClO2 and a molecular weight of 234.68 g/mol. IUPAC name: 5-chloro-2-phenylmethoxyphenol. InChIKey: LXNZCTRVSFASBU-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO2 |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 5-chloro-2-phenylmethoxyphenol |
| InChIKey | LXNZCTRVSFASBU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)Cl)O |
Computed by PubChem (NCBI)