CAS 867165-53-5 appears in our catalog under these names: (3-Chloropyrazin-2-yl)methanamine dihydrochloride, 97%, 97%, (3-Chloropyrazin-2-yl)methanamine dihydrochloride, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
(3-chloropyrazin-2-yl)methanamine;dihydrochloride (CAS 867165-53-5) is a chemical compound with the molecular formula C5H8Cl3N3 and a molecular weight of 216.5 g/mol. IUPAC name: (3-chloropyrazin-2-yl)methanamine;dihydrochloride. InChIKey: RHKWGVWUXBFIIE-UHFFFAOYSA-N.
| Molecular formula | C5H8Cl3N3 |
|---|---|
| Molecular weight | 216.5 g/mol |
| IUPAC name | (3-chloropyrazin-2-yl)methanamine;dihydrochloride |
| InChIKey | RHKWGVWUXBFIIE-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=N1)CN)Cl.Cl.Cl |
Computed by PubChem (NCBI)