CAS 1431965-15-9 is the registry number for (4,5-Dichloro-1-methyl-1H-pyrazol-3-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(4,5-dichloro-1-methylpyrazol-3-yl)methanamine;hydrochloride (CAS 1431965-15-9) is a chemical compound with the molecular formula C5H8Cl3N3 and a molecular weight of 216.5 g/mol. IUPAC name: (4,5-dichloro-1-methylpyrazol-3-yl)methanamine;hydrochloride. InChIKey: XVYJPVRVNGJWNF-UHFFFAOYSA-N.
| Molecular formula | C5H8Cl3N3 |
|---|---|
| Molecular weight | 216.5 g/mol |
| IUPAC name | (4,5-dichloro-1-methylpyrazol-3-yl)methanamine;hydrochloride |
| InChIKey | XVYJPVRVNGJWNF-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=N1)CN)Cl)Cl.Cl |
Computed by PubChem (NCBI)