CAS 2586-98-3 appears in our catalog under these names: 2-Chloropyridine-3,4-diamine hydrochloride, 95%, 2–Chloropyridine–3,4–diamine dihydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g.
2-chloropyridine-3,4-diamine;dihydrochloride (CAS 2586-98-3) is a chemical compound with the molecular formula C5H8Cl3N3 and a molecular weight of 216.5 g/mol. IUPAC name: 2-chloropyridine-3,4-diamine;dihydrochloride. InChIKey: QWAYXFGRDQYKHM-UHFFFAOYSA-N.
| Molecular formula | C5H8Cl3N3 |
|---|---|
| Molecular weight | 216.5 g/mol |
| IUPAC name | 2-chloropyridine-3,4-diamine;dihydrochloride |
| InChIKey | QWAYXFGRDQYKHM-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1N)N)Cl.Cl.Cl |
Computed by PubChem (NCBI)