cas: 1392146-21-2 — see every product listed under this CAS number, including other names
(3-FORMYL-5-METHYLPHENYL)BORONIC ACID PINACOL ESTER, 98% (CAS 1392146-21-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F807481-1G |
| cas | 1392146-21-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 664.37 Pln | |
| Fluorochem | 5g | 1856.66 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 1392146-21-2) is a chemical compound with the molecular formula C14H19BO3 and a molecular weight of 246.11 g/mol. IUPAC name: 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: CGHQBKWBUKSEBB-UHFFFAOYSA-N.
| Molecular formula | C14H19BO3 |
|---|---|
| Molecular weight | 246.11 g/mol |
| IUPAC name | 3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | CGHQBKWBUKSEBB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)C=O)C |
Computed by PubChem (NCBI)