CAS 325141-75-1 appears in our catalog under these names: 1-[2-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone, 95%, 2-Acetylphenylboronic acid pinacol ester, 2-Acetylphenylboronic acid pinacol ester, 95%, 95%, 2-Acetylphenylboronic acid pinacol ester, 95+%, 1-(2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethanone, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg.
1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone (CAS 325141-75-1) is a chemical compound with the molecular formula C14H19BO3 and a molecular weight of 246.11 g/mol. IUPAC name: 1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone. InChIKey: UTUYXAZSJTZJGG-UHFFFAOYSA-N.
| Molecular formula | C14H19BO3 |
|---|---|
| Molecular weight | 246.11 g/mol |
| IUPAC name | 1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone |
| InChIKey | UTUYXAZSJTZJGG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2C(=O)C |
Computed by PubChem (NCBI)