Products 1883540-51-9
CAS 1883540-51-9 appears in our catalog under these names: 2-(1,3-Dihydroisobenzofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 2-(1,3-Dihydroisobenzofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 500mg, 50mg, 1g.
2-(1,3-dihydro-2-benzofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1883540-51-9) is a chemical compound with the molecular formula C14H19BO3 and a molecular weight of 246.11 g/mol. IUPAC name: 2-(1,3-dihydro-2-benzofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: WCDNOHPLKMOQRH-UHFFFAOYSA-N.
| Molecular formula | C14H19BO3 |
|---|---|
| Molecular weight | 246.11 g/mol |
| IUPAC name | 2-(1,3-dihydro-2-benzofuran-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | WCDNOHPLKMOQRH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3COCC3=CC=C2 |
Computed by PubChem (NCBI)