(3-Fluoro-2-methoxypyridin-4-yl)boronic acid, 98%, 98%
cas: 1598387-84-8 — see every product listed under this CAS number, including other names
(3-Fluoro-2-methoxypyridin-4-yl)boronic acid, 98%, 98% (CAS 1598387-84-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HYKH-100mg |
| cas | 1598387-84-8 |
| size | 100mg |
| availability | 10g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 414.80 Pln | |
| Chemat | 5g | 1739.60 Pln | |
| Chemat | 500mg | 314.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3-fluoro-2-methoxy-4-pyridinyl)boronic acid (CAS 1598387-84-8) is a chemical compound with the molecular formula C6H7BFNO3 and a molecular weight of 170.94 g/mol. IUPAC name: (3-fluoro-2-methoxy-4-pyridinyl)boronic acid. InChIKey: GEAQIISIRPULKJ-UHFFFAOYSA-N.
| Molecular formula | C6H7BFNO3 |
|---|---|
| Molecular weight | 170.94 g/mol |
| IUPAC name | (3-fluoro-2-methoxy-4-pyridinyl)boronic acid |
| InChIKey | GEAQIISIRPULKJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=NC=C1)OC)F)(O)O |
Computed by PubChem (NCBI)