cas: 1072945-71-1 — see every product listed under this CAS number, including other names
(3-Fluoro-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl)boronic acid 98% (CAS 1072945-71-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A507633-100mg |
| cas | 1072945-71-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1421.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A507633 |
[3-fluoro-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid (CAS 1072945-71-1) is a chemical compound with the molecular formula C9H8BFN2O3 and a molecular weight of 221.98 g/mol. IUPAC name: [3-fluoro-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid. InChIKey: JFDXQWDZYOMAMU-UHFFFAOYSA-N.
| Molecular formula | C9H8BFN2O3 |
|---|---|
| Molecular weight | 221.98 g/mol |
| IUPAC name | [3-fluoro-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid |
| InChIKey | JFDXQWDZYOMAMU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C2=NN=C(O2)C)F)(O)O |
Computed by PubChem (NCBI)