CAS 1072945-71-1 appears in our catalog under these names: 3-Fluoro-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenylboronic acid, 98%, (3-Fluoro-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl)boronic acid, 98%, (3-Fluoro-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl)boronic acid 98%, 3-Fluoro-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenylboronic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
[3-fluoro-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid (CAS 1072945-71-1) is a chemical compound with the molecular formula C9H8BFN2O3 and a molecular weight of 221.98 g/mol. IUPAC name: [3-fluoro-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid. InChIKey: JFDXQWDZYOMAMU-UHFFFAOYSA-N.
| Molecular formula | C9H8BFN2O3 |
|---|---|
| Molecular weight | 221.98 g/mol |
| IUPAC name | [3-fluoro-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid |
| InChIKey | JFDXQWDZYOMAMU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C2=NN=C(O2)C)F)(O)O |
Computed by PubChem (NCBI)