cas: 1072945-71-1 — see every product listed under this CAS number, including other names
3-Fluoro-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenylboronic acid, 98%, 98% (CAS 1072945-71-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118WOQ-100mg |
| cas | 1072945-71-1 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 410.00 Pln | |
| Chemat | 250mg | 688.40 Pln | |
| Chemat | 1g | 1749.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[3-fluoro-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid (CAS 1072945-71-1) is a chemical compound with the molecular formula C9H8BFN2O3 and a molecular weight of 221.98 g/mol. IUPAC name: [3-fluoro-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid. InChIKey: JFDXQWDZYOMAMU-UHFFFAOYSA-N.
| Molecular formula | C9H8BFN2O3 |
|---|---|
| Molecular weight | 221.98 g/mol |
| IUPAC name | [3-fluoro-4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]boronic acid |
| InChIKey | JFDXQWDZYOMAMU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C2=NN=C(O2)C)F)(O)O |
Computed by PubChem (NCBI)