(3-Fluoro-4-(methylthio)phenyl)boronic acid, 98%
cas: 221030-80-4 — see every product listed under this CAS number, including other names
(3-Fluoro-4-(methylthio)phenyl)boronic acid, 98% (CAS 221030-80-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A416653-25g |
| cas | 221030-80-4 |
| size | 25g |
| availability | Synthetic Items: 0g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 4978.54 Pln | |
| AmBeed | 10g | 3539.83 Pln | |
| AmBeed | 250mg | 909.79 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 716.43 Pln | |
| Fluorochem | 5g | 1424.52 Pln | |
| Fluorochem | 10g | 1643.19 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3-fluoro-4-methylsulfanylphenyl)boronic acid (CAS 221030-80-4) is a chemical compound with the molecular formula C7H8BFO2S and a molecular weight of 186.02 g/mol. IUPAC name: (3-fluoro-4-methylsulfanylphenyl)boronic acid. InChIKey: CNDNUZUKUGDDGL-UHFFFAOYSA-N.
| Molecular formula | C7H8BFO2S |
|---|---|
| Molecular weight | 186.02 g/mol |
| IUPAC name | (3-fluoro-4-methylsulfanylphenyl)boronic acid |
| InChIKey | CNDNUZUKUGDDGL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)SC)F)(O)O |
Computed by PubChem (NCBI)