CAS 1451392-39-4 appears in our catalog under these names: [4-Fluoro-3-(methylsulfanyl)phenyl]boronic acid, 97%, (4-Fluoro-3-(methylthio)phenyl)boronic acid, 97%, [4-Fluoro-3-(methylsulfanyl)phenyl]boronic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 250mg, 5g, 10g, 25g, 1g.
(4-fluoro-3-methylsulfanylphenyl)boronic acid (CAS 1451392-39-4) is a chemical compound with the molecular formula C7H8BFO2S and a molecular weight of 186.02 g/mol. IUPAC name: (4-fluoro-3-methylsulfanylphenyl)boronic acid. InChIKey: KCPJDAWNJZFHKI-UHFFFAOYSA-N.
| Molecular formula | C7H8BFO2S |
|---|---|
| Molecular weight | 186.02 g/mol |
| IUPAC name | (4-fluoro-3-methylsulfanylphenyl)boronic acid |
| InChIKey | KCPJDAWNJZFHKI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)SC)(O)O |
Computed by PubChem (NCBI)