CAS 861931-38-6 appears in our catalog under these names: 4–Fluoro–2–(methylthio)phenylboronic acid, 4-Fluoro-2-(methylthio)phenylboronic acid, 98%, 98%, 4-Fluoro-2-(methylthio)phenylboronic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(4-fluoro-2-methylsulfanylphenyl)boronic acid (CAS 861931-38-6) is a chemical compound with the molecular formula C7H8BFO2S and a molecular weight of 186.02 g/mol. IUPAC name: (4-fluoro-2-methylsulfanylphenyl)boronic acid. InChIKey: BAPCTRHEOVOYPW-UHFFFAOYSA-N.
| Molecular formula | C7H8BFO2S |
|---|---|
| Molecular weight | 186.02 g/mol |
| IUPAC name | (4-fluoro-2-methylsulfanylphenyl)boronic acid |
| InChIKey | BAPCTRHEOVOYPW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)F)SC)(O)O |
Computed by PubChem (NCBI)