cas: 874219-43-9 — see every product listed under this CAS number, including other names
(3-Fluoro-5-(piperidine-1-carbonyl)phenyl)boronic acid (CAS 874219-43-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119DKK-1g |
| cas | 874219-43-9 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1144.40 Pln | |
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 462.80 Pln |
| delivery time | 3 weeks |
|---|
[3-fluoro-5-(piperidine-1-carbonyl)phenyl]boronic acid (CAS 874219-43-9) is a chemical compound with the molecular formula C12H15BFNO3 and a molecular weight of 251.06 g/mol. IUPAC name: [3-fluoro-5-(piperidine-1-carbonyl)phenyl]boronic acid. InChIKey: NOYBFSLBXRVANN-UHFFFAOYSA-N.
| Molecular formula | C12H15BFNO3 |
|---|---|
| Molecular weight | 251.06 g/mol |
| IUPAC name | [3-fluoro-5-(piperidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | NOYBFSLBXRVANN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)C(=O)N2CCCCC2)(O)O |
Computed by PubChem (NCBI)