CAS 874289-43-7 is the registry number for 2-Fluoro-5-(piperidine-1-carbonyl)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[2-fluoro-5-(piperidine-1-carbonyl)phenyl]boronic acid (CAS 874289-43-7) is a chemical compound with the molecular formula C12H15BFNO3 and a molecular weight of 251.06 g/mol. IUPAC name: [2-fluoro-5-(piperidine-1-carbonyl)phenyl]boronic acid. InChIKey: PBARTZZYZFNCJU-UHFFFAOYSA-N.
| Molecular formula | C12H15BFNO3 |
|---|---|
| Molecular weight | 251.06 g/mol |
| IUPAC name | [2-fluoro-5-(piperidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | PBARTZZYZFNCJU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)N2CCCCC2)F)(O)O |
Computed by PubChem (NCBI)