Products 874219-30-4
CAS 874219-30-4 appears in our catalog under these names: 4-Fluoro-3-(piperidine-1-carbonyl)phenylboronic acid, 98%, (4-Fluoro-3-(piperidine-1-carbonyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
[4-fluoro-3-(piperidine-1-carbonyl)phenyl]boronic acid (CAS 874219-30-4) is a chemical compound with the molecular formula C12H15BFNO3 and a molecular weight of 251.06 g/mol. IUPAC name: [4-fluoro-3-(piperidine-1-carbonyl)phenyl]boronic acid. InChIKey: LWRYZTKUVJDPFY-UHFFFAOYSA-N.
| Molecular formula | C12H15BFNO3 |
|---|---|
| Molecular weight | 251.06 g/mol |
| IUPAC name | [4-fluoro-3-(piperidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | LWRYZTKUVJDPFY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C(=O)N2CCCCC2)(O)O |
Computed by PubChem (NCBI)