cas: 2096329-73-4 — see every product listed under this CAS number, including other names
(3-Methoxy-4-(trifluoromethoxy)phenyl)boronic acid, 95% (CAS 2096329-73-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F694291-1G |
| cas | 2096329-73-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2580.36 Pln | |
| Fluorochem | 100mg | 539.41 Pln | |
| Fluorochem | 250mg | 862.21 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[3-methoxy-4-(trifluoromethoxy)phenyl]boronic acid (CAS 2096329-73-4) is a chemical compound with the molecular formula C8H8BF3O4 and a molecular weight of 235.95 g/mol. IUPAC name: [3-methoxy-4-(trifluoromethoxy)phenyl]boronic acid. InChIKey: XDTGEHAWZFDFPU-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O4 |
|---|---|
| Molecular weight | 235.95 g/mol |
| IUPAC name | [3-methoxy-4-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | XDTGEHAWZFDFPU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC(F)(F)F)OC)(O)O |
Computed by PubChem (NCBI)