CAS 290832-43-8 appears in our catalog under these names: 2-Methoxy-5-(trifluoromethoxy)phenylboronic acid, 98%, (2–Methoxy–5–(trifluoromethoxy)phenyl)boronic acid, (2-Methoxy-5-(trifluoromethoxy)phenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 100mg, 10g.
[2-methoxy-5-(trifluoromethoxy)phenyl]boronic acid (CAS 290832-43-8) is a chemical compound with the molecular formula C8H8BF3O4 and a molecular weight of 235.95 g/mol. IUPAC name: [2-methoxy-5-(trifluoromethoxy)phenyl]boronic acid. InChIKey: PZDNMFGRXYPDJA-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O4 |
|---|---|
| Molecular weight | 235.95 g/mol |
| IUPAC name | [2-methoxy-5-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | PZDNMFGRXYPDJA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC(F)(F)F)OC)(O)O |
Computed by PubChem (NCBI)