Products 2121514-23-4

CAS 2121514-23-4 is the registry number for 2-(Hydroxymethyl)-5-(trifluoromethoxy)phenylboronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

[2-(hydroxymethyl)-5-(trifluoromethoxy)phenyl]boronic acid (CAS 2121514-23-4) is a chemical compound with the molecular formula C8H8BF3O4 and a molecular weight of 235.95 g/mol. IUPAC name: [2-(hydroxymethyl)-5-(trifluoromethoxy)phenyl]boronic acid. InChIKey: ZNZVOBOHYHVJFB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8BF3O4
Molecular weight235.95 g/mol
IUPAC name[2-(hydroxymethyl)-5-(trifluoromethoxy)phenyl]boronic acid
InChIKeyZNZVOBOHYHVJFB-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1)OC(F)(F)F)CO)(O)O

Computed by PubChem (NCBI)