CAS 892502-12-4 is the registry number for (3-Pyrimidin-2-ylphenyl)methanol, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g, 5g.
(3-pyrimidin-2-ylphenyl)methanol (CAS 892502-12-4) is a chemical compound with the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. IUPAC name: (3-pyrimidin-2-ylphenyl)methanol. InChIKey: WMNXGJMCXOLBBV-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | (3-pyrimidin-2-ylphenyl)methanol |
| InChIKey | WMNXGJMCXOLBBV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=NC=CC=N2)CO |
Computed by PubChem (NCBI)