CAS 449758-41-2 appears in our catalog under these names: [2-(Pyrazin-2-yl)phenyl]methanol, 96%, (2-(Pyrazin-2-yl)phenyl)methanol 96%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 250mg, 100mg.
(2-pyrazin-2-ylphenyl)methanol (CAS 449758-41-2) is a chemical compound with the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. IUPAC name: (2-pyrazin-2-ylphenyl)methanol. InChIKey: ZCDGYDMUPLMDOQ-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | (2-pyrazin-2-ylphenyl)methanol |
| InChIKey | ZCDGYDMUPLMDOQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CO)C2=NC=CN=C2 |
Computed by PubChem (NCBI)