cas: 122536-77-0 — see every product listed under this CAS number, including other names
(3R)-(+)-3-(tert-Butoxycarbonylamino)pyrrolidine, 97% (CAS 122536-77-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009067-5G |
| cas | 122536-77-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 143.72 Pln | |
| Fluorochem | 10g | 185.37 Pln | |
| Fluorochem | 25g | 362.39 Pln | |
| Fluorochem | 100g | 1268.32 Pln | |
| Fluorochem | 500g | 4782.71 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl N-[(3R)-pyrrolidin-3-yl]carbamate (CAS 122536-77-0) is a chemical compound with the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. IUPAC name: tert-butyl N-[(3R)-pyrrolidin-3-yl]carbamate. InChIKey: DQQJBEAXSOOCPG-SSDOTTSWSA-N.
| Molecular formula | C9H18N2O2 |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | tert-butyl N-[(3R)-pyrrolidin-3-yl]carbamate |
| InChIKey | DQQJBEAXSOOCPG-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCNC1 |
Computed by PubChem (NCBI)