cas: 122536-77-0 — see every product listed under this CAS number, including other names
(R)-3-(tert-Butoxycarbonylamino)pyrrolidine, 98%, 98% (CAS 122536-77-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143F3-1g |
| cas | 122536-77-0 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 160.40 Pln | |
| Chemat | 25g | 270.80 Pln | |
| Chemat | 50g | 458.00 Pln | |
| Chemat | 100g | 818.00 Pln | |
| Chemat | 250g | 1782.80 Pln | |
| Chemat | 500g | 3302.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(3R)-pyrrolidin-3-yl]carbamate (CAS 122536-77-0) is a chemical compound with the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. IUPAC name: tert-butyl N-[(3R)-pyrrolidin-3-yl]carbamate. InChIKey: DQQJBEAXSOOCPG-SSDOTTSWSA-N.
| Molecular formula | C9H18N2O2 |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | tert-butyl N-[(3R)-pyrrolidin-3-yl]carbamate |
| InChIKey | DQQJBEAXSOOCPG-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCNC1 |
Computed by PubChem (NCBI)