cas: 122536-77-0 — see every product listed under this CAS number, including other names
(R)-3-(Boc-amino)pyrrolidine, 99.92% (CAS 122536-77-0) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W002421-10 g |
| cas | 122536-77-0 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 277.90 Pln | |
| MedChemExpress | 5 g | 240.74 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.92% |
Tert-butyl N-[(3R)-pyrrolidin-3-yl]carbamate (CAS 122536-77-0) is a chemical compound with the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. IUPAC name: tert-butyl N-[(3R)-pyrrolidin-3-yl]carbamate. InChIKey: DQQJBEAXSOOCPG-SSDOTTSWSA-N.
| Molecular formula | C9H18N2O2 |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | tert-butyl N-[(3R)-pyrrolidin-3-yl]carbamate |
| InChIKey | DQQJBEAXSOOCPG-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCNC1 |
Computed by PubChem (NCBI)