cas: 1062580-52-2 — see every product listed under this CAS number, including other names
(3R,4R)-1-Benzyl-N,4-dimethylpiperidin-3-amine dihydrochloride, 95%, 95% (CAS 1062580-52-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149C1-1g |
| cas | 1062580-52-2 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 189.20 Pln | |
| Chemat | 25g | 309.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3R,4R)-1-benzyl-N,4-dimethylpiperidin-3-amine;dihydrochloride (CAS 1062580-52-2) is a chemical compound with the molecular formula C14H24Cl2N2 and a molecular weight of 291.3 g/mol. IUPAC name: (3R,4R)-1-benzyl-N,4-dimethylpiperidin-3-amine;dihydrochloride. InChIKey: CVQNXCBXFOIHLH-DAIKJZOUSA-N.
| Molecular formula | C14H24Cl2N2 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | (3R,4R)-1-benzyl-N,4-dimethylpiperidin-3-amine;dihydrochloride |
| InChIKey | CVQNXCBXFOIHLH-DAIKJZOUSA-N |
| SMILES | C[C@@H]1CCN(C[C@@H]1NC)CC2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)