cas: 1062580-52-2 — see every product listed under this CAS number, including other names
(3R,4R)-1-Benzyl-N,4-dimethylpiperidin-3-amine dihydrochloride, 95% (CAS 1062580-52-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F050708-1G |
| cas | 1062580-52-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 10g | 263.47 Pln | |
| Fluorochem | 25g | 487.35 Pln | |
| Fluorochem | 100g | 1752.53 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(3R,4R)-1-benzyl-N,4-dimethylpiperidin-3-amine;dihydrochloride (CAS 1062580-52-2) is a chemical compound with the molecular formula C14H24Cl2N2 and a molecular weight of 291.3 g/mol. IUPAC name: (3R,4R)-1-benzyl-N,4-dimethylpiperidin-3-amine;dihydrochloride. InChIKey: CVQNXCBXFOIHLH-DAIKJZOUSA-N.
| Molecular formula | C14H24Cl2N2 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | (3R,4R)-1-benzyl-N,4-dimethylpiperidin-3-amine;dihydrochloride |
| InChIKey | CVQNXCBXFOIHLH-DAIKJZOUSA-N |
| SMILES | C[C@@H]1CCN(C[C@@H]1NC)CC2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)