cas: 1207853-61-9 — see every product listed under this CAS number, including other names
(3R,4R)-3-Amino-4-methyl-1-piperidinecarboxylic acid 1,1-dimethylethyl ester, 95%, 95% (CAS 1207853-61-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1106U4-50mg |
| cas | 1207853-61-9 |
| size | 50mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 760.40 Pln | |
| Chemat | 100mg | 1101.20 Pln | |
| Chemat | 250mg | 1816.40 Pln | |
| Chemat | 1g | 4197.20 Pln | |
| Chemat | 5g | 14901.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3R,4R)-3-amino-4-methylpiperidine-1-carboxylate (CAS 1207853-61-9) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl (3R,4R)-3-amino-4-methylpiperidine-1-carboxylate. InChIKey: OWWPBKGSGNQMPL-BDAKNGLRSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl (3R,4R)-3-amino-4-methylpiperidine-1-carboxylate |
| InChIKey | OWWPBKGSGNQMPL-BDAKNGLRSA-N |
| SMILES | C[C@@H]1CCN(C[C@@H]1N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)