cas: 1207853-61-9 — see every product listed under this CAS number, including other names
(3R,4R)-tert-Butyl 3-amino-4-methylpiperidine-1-carboxylate 95% (CAS 1207853-61-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A480747-50mg |
| cas | 1207853-61-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 1071.25 Pln | |
| Ambeed | 100mg | 1744.31 Pln | |
| Ambeed | 250mg | 3435.31 Pln | |
| Ambeed | 1g | 8369.25 Pln | |
| Ambeed | 5g | 25318.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A480747 |
Tert-butyl (3R,4R)-3-amino-4-methylpiperidine-1-carboxylate (CAS 1207853-61-9) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl (3R,4R)-3-amino-4-methylpiperidine-1-carboxylate. InChIKey: OWWPBKGSGNQMPL-BDAKNGLRSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl (3R,4R)-3-amino-4-methylpiperidine-1-carboxylate |
| InChIKey | OWWPBKGSGNQMPL-BDAKNGLRSA-N |
| SMILES | C[C@@H]1CCN(C[C@@H]1N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)