cas: 1523530-38-2 — see every product listed under this CAS number, including other names
(3R,4R)-4-Aminotetrahydro-2H-pyran-3-ol hydrochloride, 95%, 95% (CAS 1523530-38-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HXYX-100mg |
| cas | 1523530-38-2 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 500mg | 174.80 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 880.40 Pln | |
| Chemat | 10g | 1624.40 Pln | |
| Chemat | 25g | 3035.60 Pln | |
| Chemat | 100g | 10274.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3R,4R)-4-aminooxan-3-ol;hydrochloride (CAS 1523530-38-2) is a chemical compound with the molecular formula C5H12ClNO2 and a molecular weight of 153.61 g/mol. IUPAC name: (3R,4R)-4-aminooxan-3-ol;hydrochloride. InChIKey: GZXXMEFWSWRREY-JBUOLDKXSA-N.
| Molecular formula | C5H12ClNO2 |
|---|---|
| Molecular weight | 153.61 g/mol |
| IUPAC name | (3R,4R)-4-aminooxan-3-ol;hydrochloride |
| InChIKey | GZXXMEFWSWRREY-JBUOLDKXSA-N |
| SMILES | C1COC[C@@H]([C@@H]1N)O.Cl |
Computed by PubChem (NCBI)