cas: 2682097-79-4 — see every product listed under this CAS number, including other names
(3R,4R)-Benzyl 3-amino-4-methylpyrrolidine-1-carboxylate hydrochloride, 95%, 95% (CAS 2682097-79-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12XDBN-1g |
| cas | 2682097-79-4 |
| size | 1g |
| availability | 13g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 6414.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Benzyl (3R,4R)-3-amino-4-methylpyrrolidine-1-carboxylate;hydrochloride (CAS 2682097-79-4) is a chemical compound with the molecular formula C13H19ClN2O2 and a molecular weight of 270.75 g/mol. IUPAC name: benzyl (3R,4R)-3-amino-4-methylpyrrolidine-1-carboxylate;hydrochloride. InChIKey: XIVVOEPXDFGLFB-IYJPBCIQSA-N.
| Molecular formula | C13H19ClN2O2 |
|---|---|
| Molecular weight | 270.75 g/mol |
| IUPAC name | benzyl (3R,4R)-3-amino-4-methylpyrrolidine-1-carboxylate;hydrochloride |
| InChIKey | XIVVOEPXDFGLFB-IYJPBCIQSA-N |
| SMILES | C[C@@H]1CN(C[C@@H]1N)C(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)