Products 1217707-96-4

CAS 1217707-96-4 is the registry number for (R)-Benzyl 2-(aminomethyl)pyrrolidine-1-carboxylate hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

Benzyl (2R)-2-(aminomethyl)pyrrolidine-1-carboxylate;hydrochloride (CAS 1217707-96-4) is a chemical compound with the molecular formula C13H19ClN2O2 and a molecular weight of 270.75 g/mol. IUPAC name: benzyl (2R)-2-(aminomethyl)pyrrolidine-1-carboxylate;hydrochloride. InChIKey: ONODQZLASNRARN-UTONKHPSSA-N.

Identity
Molecular formulaC13H19ClN2O2
Molecular weight270.75 g/mol
IUPAC namebenzyl (2R)-2-(aminomethyl)pyrrolidine-1-carboxylate;hydrochloride
InChIKeyONODQZLASNRARN-UTONKHPSSA-N
SMILESC1C[C@@H](N(C1)C(=O)OCC2=CC=CC=C2)CN.Cl

Computed by PubChem (NCBI)