CAS 1217707-96-4 is the registry number for (R)-Benzyl 2-(aminomethyl)pyrrolidine-1-carboxylate hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g, 250mg, 100mg.
Benzyl (2R)-2-(aminomethyl)pyrrolidine-1-carboxylate;hydrochloride (CAS 1217707-96-4) is a chemical compound with the molecular formula C13H19ClN2O2 and a molecular weight of 270.75 g/mol. IUPAC name: benzyl (2R)-2-(aminomethyl)pyrrolidine-1-carboxylate;hydrochloride. InChIKey: ONODQZLASNRARN-UTONKHPSSA-N.
| Molecular formula | C13H19ClN2O2 |
|---|---|
| Molecular weight | 270.75 g/mol |
| IUPAC name | benzyl (2R)-2-(aminomethyl)pyrrolidine-1-carboxylate;hydrochloride |
| InChIKey | ONODQZLASNRARN-UTONKHPSSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)OCC2=CC=CC=C2)CN.Cl |
Computed by PubChem (NCBI)