Products 2682097-79-4
CAS 2682097-79-4 appears in our catalog under these names: Benzyl (3r,4r)-3-amino-4-methylpyrrolidine-1-carboxylate hydrochloride, 95%, (3R,4R)-Benzyl 3-amino-4-methylpyrrolidine-1-carboxylate hydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 100mg, 1g.
Benzyl (3R,4R)-3-amino-4-methylpyrrolidine-1-carboxylate;hydrochloride (CAS 2682097-79-4) is a chemical compound with the molecular formula C13H19ClN2O2 and a molecular weight of 270.75 g/mol. IUPAC name: benzyl (3R,4R)-3-amino-4-methylpyrrolidine-1-carboxylate;hydrochloride. InChIKey: XIVVOEPXDFGLFB-IYJPBCIQSA-N.
| Molecular formula | C13H19ClN2O2 |
|---|---|
| Molecular weight | 270.75 g/mol |
| IUPAC name | benzyl (3R,4R)-3-amino-4-methylpyrrolidine-1-carboxylate;hydrochloride |
| InChIKey | XIVVOEPXDFGLFB-IYJPBCIQSA-N |
| SMILES | C[C@@H]1CN(C[C@@H]1N)C(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)