cas: 1033718-91-0 — see every product listed under this CAS number, including other names
(3R,4S)-(4-Fluoro-pyrrolidin-3-yl)carbamic acid tert-butyl ester, 97%, 97% (CAS 1033718-91-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1103OX-100mg |
| cas | 1033718-91-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 986.00 Pln | |
| Chemat | 1g | 2886.80 Pln | |
| Chemat | 5g | 10461.20 Pln | |
| Chemat | 10g | 16648.40 Pln | |
| Chemat | 500mg | 1638.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(3R,4S)-4-fluoropyrrolidin-3-yl]carbamate (CAS 1033718-91-0) is a chemical compound with the molecular formula C9H17FN2O2 and a molecular weight of 204.24 g/mol. IUPAC name: tert-butyl N-[(3R,4S)-4-fluoropyrrolidin-3-yl]carbamate. InChIKey: BZSDDSIFAGBZLT-NKWVEPMBSA-N.
| Molecular formula | C9H17FN2O2 |
|---|---|
| Molecular weight | 204.24 g/mol |
| IUPAC name | tert-butyl N-[(3R,4S)-4-fluoropyrrolidin-3-yl]carbamate |
| InChIKey | BZSDDSIFAGBZLT-NKWVEPMBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CNC[C@@H]1F |
Computed by PubChem (NCBI)