cas: 1033718-91-0 — see every product listed under this CAS number, including other names
(3R,4S)-3-(BOC-AMINO)-4-FLUORO-PYRROLIDINE, 98% (CAS 1033718-91-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467955-100MG |
| cas | 1033718-91-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 378.01 Pln | |
| Fluorochem | 250mg | 622.72 Pln | |
| Fluorochem | 500mg | 1190.22 Pln | |
| Fluorochem | 1g | 2325.24 Pln | |
| Fluorochem | 5g | 11400.17 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[(3R,4S)-4-fluoropyrrolidin-3-yl]carbamate (CAS 1033718-91-0) is a chemical compound with the molecular formula C9H17FN2O2 and a molecular weight of 204.24 g/mol. IUPAC name: tert-butyl N-[(3R,4S)-4-fluoropyrrolidin-3-yl]carbamate. InChIKey: BZSDDSIFAGBZLT-NKWVEPMBSA-N.
| Molecular formula | C9H17FN2O2 |
|---|---|
| Molecular weight | 204.24 g/mol |
| IUPAC name | tert-butyl N-[(3R,4S)-4-fluoropyrrolidin-3-yl]carbamate |
| InChIKey | BZSDDSIFAGBZLT-NKWVEPMBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CNC[C@@H]1F |
Computed by PubChem (NCBI)