cas: 1033718-91-0 — see every product listed under this CAS number, including other names
tert-Butyl ((3R,4S)-4-fluoropyrrolidin-3-yl)carbamate 97% (CAS 1033718-91-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A447583-100mg |
| cas | 1033718-91-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 576.19 Pln | |
| Ambeed | 250mg | 1332.69 Pln | |
| Ambeed | 1g | 3635.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A447583 |
Tert-butyl N-[(3R,4S)-4-fluoropyrrolidin-3-yl]carbamate (CAS 1033718-91-0) is a chemical compound with the molecular formula C9H17FN2O2 and a molecular weight of 204.24 g/mol. IUPAC name: tert-butyl N-[(3R,4S)-4-fluoropyrrolidin-3-yl]carbamate. InChIKey: BZSDDSIFAGBZLT-NKWVEPMBSA-N.
| Molecular formula | C9H17FN2O2 |
|---|---|
| Molecular weight | 204.24 g/mol |
| IUPAC name | tert-butyl N-[(3R,4S)-4-fluoropyrrolidin-3-yl]carbamate |
| InChIKey | BZSDDSIFAGBZLT-NKWVEPMBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CNC[C@@H]1F |
Computed by PubChem (NCBI)