cas: 1423037-48-2 — see every product listed under this CAS number, including other names
(3R,4S)-rel-4-(3-Bromophenyl)pyrrolidine-3-carboxylic acid hydrochloride, 95+% (CAS 1423037-48-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A648789-1g |
| cas | 1423037-48-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 9125.41 Pln | |
| AmBeed | 5g | 32991.07 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3R,4S)-4-(3-bromophenyl)pyrrolidine-3-carboxylic acid;hydrochloride (CAS 1423037-48-2) is a chemical compound with the molecular formula C11H13BrClNO2 and a molecular weight of 306.58 g/mol. IUPAC name: (3R,4S)-4-(3-bromophenyl)pyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: RIBXZLYDHCWZCF-UXQCFNEQSA-N.
| Molecular formula | C11H13BrClNO2 |
|---|---|
| Molecular weight | 306.58 g/mol |
| IUPAC name | (3R,4S)-4-(3-bromophenyl)pyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | RIBXZLYDHCWZCF-UXQCFNEQSA-N |
| SMILES | C1[C@@H]([C@H](CN1)C(=O)O)C2=CC(=CC=C2)Br.Cl |
Computed by PubChem (NCBI)